C19H24N2O2 — CID 50902028
1-cyclohexyl-8,9-dimethoxy-5,6-dihydroimidazo[5,1-a]isoquinoline (PubChem CID 50902028) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1-cyclohexyl-8,9-dimethoxy-5,6-dihydroimidazo[5,1-a]isoquinoline.
| Compound Name | 1-cyclohexyl-8,9-dimethoxy-5,6-dihydroimidazo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 50902028 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 1-cyclohexyl-8,9-dimethoxy-5,6-dihydroimidazo[5,1-a]isoquinoline |
| SMILES | COc1cc2c(cc1OC)-c1c(C3CCCCC3)ncn1CC2 |
| InChI | InChI=1S/C19H24N2O2/c1-22-16-10-14-8-9-21-12-20-18(13-6-4-3-5-7-13)19(21)15(14)11-17(16)23-2/h10-13H,3-9H2,1-2H3 |
| InChIKey | KUWKIEDCDSZEHG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |