C19H18N2O2 — CID 50902029
8,9-dimethoxy-1-phenyl-5,6-dihydroimidazo[5,1-a]isoquinoline (PubChem CID 50902029) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 8,9-dimethoxy-1-phenyl-5,6-dihydroimidazo[5,1-a]isoquinoline.
| Compound Name | 8,9-dimethoxy-1-phenyl-5,6-dihydroimidazo[5,1-a]isoquinoline |
|---|---|
| PubChem CID | 50902029 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 8,9-dimethoxy-1-phenyl-5,6-dihydroimidazo[5,1-a]isoquinoline |
| SMILES | COc1cc2c(cc1OC)-c1c(-c3ccccc3)ncn1CC2 |
| InChI | InChI=1S/C19H18N2O2/c1-22-16-10-14-8-9-21-12-20-18(13-6-4-3-5-7-13)19(21)15(14)11-17(16)23-2/h3-7,10-12H,8-9H2,1-2H3 |
| InChIKey | VNGKMURMGUXGAN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |