C25H22Cl2N4O2 — CID 50902099
4-[(2,4-dichlorophenyl)methoxy]-1-(9-methyl-7,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-6-yl)pyridin-2-one (PubChem CID 50902099) has the molecular formula C25H22Cl2N4O2 and a molecular weight of 481.38 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methoxy]-1-(9-methyl-7,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-6-yl)pyridin-2-one.
| Compound Name | 4-[(2,4-dichlorophenyl)methoxy]-1-(9-methyl-7,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-6-yl)pyridin-2-one |
|---|---|
| PubChem CID | 50902099 |
| Molecular Formula | C25H22Cl2N4O2 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methoxy]-1-(9-methyl-7,9,15-triazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-6-yl)pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(OCc5ccc(Cl)cc5Cl)cc4=O)nc31)C1CCC(C2)N1 |
| InChI | InChI=1S/C25H22Cl2N4O2/c1-30-21-11-16-4-6-20(28-16)24(21)18-5-7-22(29-25(18)30)31-9-8-17(12-23(31)32)33-13-14-2-3-15(26)10-19(14)27/h2-3,5,7-10,12,16,20,28H,4,6,11,13H2,1H3 |
| InChIKey | XIQLUZUSNRGLCE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |