C17H16F2N4OS — CID 50903048
(4aS,8aS)-8a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine (PubChem CID 50903048) has the molecular formula C17H16F2N4OS and a molecular weight of 362.41 g/mol. Its IUPAC name is (4aS,8aS)-8a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine.
| Compound Name | (4aS,8aS)-8a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 50903048 |
| Molecular Formula | C17H16F2N4OS |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (4aS,8aS)-8a-(2,4-difluoro-5-pyrimidin-5-ylphenyl)-4a,5,7,8-tetrahydro-4H-pyrano[4,3-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3cc(-c4cncnc4)c(F)cc3F)CCOC[C@H]2CS1 |
| InChI | InChI=1S/C17H16F2N4OS/c18-14-4-15(19)13(3-12(14)10-5-21-9-22-6-10)17-1-2-24-7-11(17)8-25-16(20)23-17/h3-6,9,11H,1-2,7-8H2,(H2,20,23)/t11-,17-/m0/s1 |
| InChIKey | RENWWEUSGUDRJT-GTNSWQLSSA-N |
| XLogP | 2.72 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |