C25H21F3N4O — CID 50903066
1-(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-6-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one (PubChem CID 50903066) has the molecular formula C25H21F3N4O and a molecular weight of 450.46 g/mol. Its IUPAC name is 1-(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-6-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one.
| Compound Name | 1-(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-6-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
|---|---|
| PubChem CID | 50903066 |
| Molecular Formula | C25H21F3N4O |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 1-(9-methyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-6-yl)-4-[5-(trifluoromethyl)-2-pyridinyl]pyridin-2-one |
| SMILES | Cn1c2c(c3ccc(-n4ccc(-c5ccc(C(F)(F)F)cn5)cc4=O)cc31)C1CCC(C2)N1 |
| InChI | InChI=1S/C25H21F3N4O/c1-31-21-12-17(4-5-18(21)24-20-7-3-16(30-20)11-22(24)31)32-9-8-14(10-23(32)33)19-6-2-15(13-29-19)25(26,27)28/h2,4-6,8-10,12-13,16,20,30H,3,7,11H2,1H3 |
| InChIKey | WSPSSCWJQMVPSM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|