C29H37N3O5 — CID 50903229
4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-8,9-dihydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 50903229) has the molecular formula C29H37N3O5 and a molecular weight of 507.63 g/mol. Its IUPAC name is 4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-8,9-dihydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | 4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-8,9-dihydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 50903229 |
| Molecular Formula | C29H37N3O5 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | 4-[[(1S,2S)-2-[[4-(1,2-benzoxazol-3-yl)piperidin-1-yl]methyl]cyclohexyl]methyl]-8,9-dihydroxy-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | O=C1C2C3CC(C(O)C3O)C2C(=O)N1C[C@H]1CCCC[C@@H]1CN1CCC(c2noc3ccccc23)CC1 |
| InChI | InChI=1S/C29H37N3O5/c33-26-20-13-21(27(26)34)24-23(20)28(35)32(29(24)36)15-18-6-2-1-5-17(18)14-31-11-9-16(10-12-31)25-19-7-3-4-8-22(19)37-30-25/h3-4,7-8,16-18,20-21,23-24,26-27,33-34H,1-2,5-6,9-15H2/t17-,18-,20?,21?,23?,24?,26?,27?/m1/s1 |
| InChIKey | PHUAKKUXZOEKCP-ODMQKGIESA-N |
| XLogP | 2.79 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|