About methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate
methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 50903563) has the molecular formula C9H10ClNO2
and a molecular weight of 199.64 g/mol. Its IUPAC name is methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| PubChem CID | 50903563 |
| Molecular Formula | C9H10ClNO2 |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C)cc(C)nc1Cl |
| InChI | InChI=1S/C9H10ClNO2/c1-5-4-6(2)11-8(10)7(5)9(12)13-3/h4H,1-3H3 |
| InChIKey | JIWYJFSOPRWMOF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate?
The IUPAC name of methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate (CID 50903563) is methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate.
What is the SMILES notation for methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate?
The canonical SMILES for methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate is COC(=O)c1c(C)cc(C)nc1Cl.
What is the InChIKey of methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate?
The InChIKey is JIWYJFSOPRWMOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2/c1-5-4-6(2)11-8(10)7(5)9(12)13-3/h4H,1-3H3.
What are the key properties of methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate?
methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate has a molecular weight of 199.64 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-chloro-4,6-dimethylpyridine-3-carboxylate is sourced from PubChem (CID 50903563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).