C32H22F3N7O2 — CID 5090374
15-methyl-17-(3-nitrophenyl)-13-phenyl-N-[3-(trifluoromethyl)phenyl]-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine (PubChem CID 5090374) has the molecular formula C32H22F3N7O2 and a molecular weight of 593.57 g/mol. Its IUPAC name is 15-methyl-17-(3-nitrophenyl)-13-phenyl-N-[3-(trifluoromethyl)phenyl]-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine.
| Compound Name | 15-methyl-17-(3-nitrophenyl)-13-phenyl-N-[3-(trifluoromethyl)phenyl]-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
|---|---|
| PubChem CID | 5090374 |
| Molecular Formula | C32H22F3N7O2 |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | 15-methyl-17-(3-nitrophenyl)-13-phenyl-N-[3-(trifluoromethyl)phenyl]-1,8,11,13,14-pentazatetracyclo[8.7.0.02,7.012,16]heptadeca-2,4,6,8,10,12(16),14-heptaen-9-amine |
| SMILES | Cc1nn(-c2ccccc2)c2c1C(c1cccc([N+](=O)[O-])c1)N1C(=N2)C(Nc2cccc(C(F)(F)F)c2)=Nc2ccccc21 |
| InChI | InChI=1S/C32H22F3N7O2/c1-19-27-28(20-9-7-14-24(17-20)42(43)44)40-26-16-6-5-15-25(26)37-29(36-22-11-8-10-21(18-22)32(33,34)35)31(40)38-30(27)41(39-19)23-12-3-2-4-13-23/h2-18,28H,1H3,(H,36,37) |
| InChIKey | NXFSIZSYBIIPBH-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 100.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|