C17H25NO2S — CID 50904040
(1R,5R)-6-benzylsulfonyl-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane (PubChem CID 50904040) has the molecular formula C17H25NO2S and a molecular weight of 307.46 g/mol. Its IUPAC name is (1R,5R)-6-benzylsulfonyl-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5R)-6-benzylsulfonyl-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 50904040 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (1R,5R)-6-benzylsulfonyl-1,3,3-trimethyl-6-azabicyclo[3.2.1]octane |
| SMILES | CC1(C)C[C@@H]2C[C@](C)(CN2S(=O)(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C17H25NO2S/c1-16(2)9-15-10-17(3,12-16)13-18(15)21(19,20)11-14-7-5-4-6-8-14/h4-8,15H,9-13H2,1-3H3/t15-,17+/m1/s1 |
| InChIKey | NQDOMBRQXKSSNQ-WBVHZDCISA-N |
| XLogP | 3.42 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |