C27H34NO+ — CID 50904244
1,1-diphenyl-5-[(1R,5R)-1,3,3-trimethyl-6-azoniabicyclo[3.2.1]octan-6-yl]pent-3-yn-1-ol (PubChem CID 50904244) has the molecular formula C27H34NO+ and a molecular weight of 388.58 g/mol. Its IUPAC name is 1,1-diphenyl-5-[(1R,5R)-1,3,3-trimethyl-6-azoniabicyclo[3.2.1]octan-6-yl]pent-3-yn-1-ol.
| Compound Name | 1,1-diphenyl-5-[(1R,5R)-1,3,3-trimethyl-6-azoniabicyclo[3.2.1]octan-6-yl]pent-3-yn-1-ol |
|---|---|
| PubChem CID | 50904244 |
| Molecular Formula | C27H34NO+ |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | 1,1-diphenyl-5-[(1R,5R)-1,3,3-trimethyl-6-azoniabicyclo[3.2.1]octan-6-yl]pent-3-yn-1-ol |
| SMILES | CC1(C)C[C@@H]2C[C@](C)(C[NH+]2CC#CCC(O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C27H33NO/c1-25(2)18-24-19-26(3,20-25)21-28(24)17-11-10-16-27(29,22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-9,12-15,24,29H,16-21H2,1-3H3/p+1/t24-,26+/m1/s1 |
| InChIKey | PBANIAXWFLATDN-RSXGOPAZSA-O |
| XLogP | 3.80 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|