C22H22N2O3 — CID 50904275
3-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-naphthalen-1-ylpropanamide (PubChem CID 50904275) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-naphthalen-1-ylpropanamide.
| Compound Name | 3-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-naphthalen-1-ylpropanamide |
|---|---|
| PubChem CID | 50904275 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 3-[(1R,2S,6R,7R)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl]-N-naphthalen-1-ylpropanamide |
| SMILES | O=C(CCN1C(=O)[C@@H]2[C@@H]3CC[C@H](C3)[C@@H]2C1=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C22H22N2O3/c25-18(23-17-7-3-5-13-4-1-2-6-16(13)17)10-11-24-21(26)19-14-8-9-15(12-14)20(19)22(24)27/h1-7,14-15,19-20H,8-12H2,(H,23,25)/t14-,15-,19-,20+/m1/s1 |
| InChIKey | NBHBFHYNRGLWDT-IONDEXAJSA-N |
| XLogP | 3.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|