C20H21N5O2 — CID 50904396
N'-(6-ethoxy-1,2,3,4-tetrahydroacridin-9-yl)pyrazine-2-carbohydrazide (PubChem CID 50904396) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is N'-(6-ethoxy-1,2,3,4-tetrahydroacridin-9-yl)pyrazine-2-carbohydrazide.
| Compound Name | N'-(6-ethoxy-1,2,3,4-tetrahydroacridin-9-yl)pyrazine-2-carbohydrazide |
|---|---|
| PubChem CID | 50904396 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N'-(6-ethoxy-1,2,3,4-tetrahydroacridin-9-yl)pyrazine-2-carbohydrazide |
| SMILES | CCOc1ccc2c(NNC(=O)c3cnccn3)c3c(nc2c1)CCCC3 |
| InChI | InChI=1S/C20H21N5O2/c1-2-27-13-7-8-15-17(11-13)23-16-6-4-3-5-14(16)19(15)24-25-20(26)18-12-21-9-10-22-18/h7-12H,2-6H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | MKRBSSQZZJBYMP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|