C27H25ClN2O5 — CID 50904474
[2-[4-chloro-5-(4-methoxyphenoxy)-6-oxopyridazin-1-yl]-2-naphthalen-1-ylethyl] butanoate (PubChem CID 50904474) has the molecular formula C27H25ClN2O5 and a molecular weight of 492.96 g/mol. Its IUPAC name is [2-[4-chloro-5-(4-methoxyphenoxy)-6-oxopyridazin-1-yl]-2-naphthalen-1-ylethyl] butanoate.
| Compound Name | [2-[4-chloro-5-(4-methoxyphenoxy)-6-oxopyridazin-1-yl]-2-naphthalen-1-ylethyl] butanoate |
|---|---|
| PubChem CID | 50904474 |
| Molecular Formula | C27H25ClN2O5 |
| Molecular Weight | 492.96 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | [2-[4-chloro-5-(4-methoxyphenoxy)-6-oxopyridazin-1-yl]-2-naphthalen-1-ylethyl] butanoate |
| SMILES | CCCC(=O)OCC(c1cccc2ccccc12)n1ncc(Cl)c(Oc2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C27H25ClN2O5/c1-3-7-25(31)34-17-24(22-11-6-9-18-8-4-5-10-21(18)22)30-27(32)26(23(28)16-29-30)35-20-14-12-19(33-2)13-15-20/h4-6,8-16,24H,3,7,17H2,1-2H3 |
| InChIKey | YHMMNTRBWINPAL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.96 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |