About methyl 3,5-dipyridin-2-ylbenzoate
methyl 3,5-dipyridin-2-ylbenzoate (PubChem CID 50905009) has the molecular formula C18H14N2O2
and a molecular weight of 290.32 g/mol. Its IUPAC name is methyl 3,5-dipyridin-2-ylbenzoate.
Molecular Properties
| Compound Name | methyl 3,5-dipyridin-2-ylbenzoate |
| PubChem CID | 50905009 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | methyl 3,5-dipyridin-2-ylbenzoate |
| SMILES | COC(=O)c1cc(-c2ccccn2)cc(-c2ccccn2)c1 |
| InChI | InChI=1S/C18H14N2O2/c1-22-18(21)15-11-13(16-6-2-4-8-19-16)10-14(12-15)17-7-3-5-9-20-17/h2-12H,1H3 |
| InChIKey | ZDTQROCOZIMDLE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3,5-dipyridin-2-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3,5-dipyridin-2-ylbenzoate?
The IUPAC name of methyl 3,5-dipyridin-2-ylbenzoate (CID 50905009) is methyl 3,5-dipyridin-2-ylbenzoate.
What is the SMILES notation for methyl 3,5-dipyridin-2-ylbenzoate?
The canonical SMILES for methyl 3,5-dipyridin-2-ylbenzoate is COC(=O)c1cc(-c2ccccn2)cc(-c2ccccn2)c1.
What is the InChIKey of methyl 3,5-dipyridin-2-ylbenzoate?
The InChIKey is ZDTQROCOZIMDLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O2/c1-22-18(21)15-11-13(16-6-2-4-8-19-16)10-14(12-15)17-7-3-5-9-20-17/h2-12H,1H3.
What are the key properties of methyl 3,5-dipyridin-2-ylbenzoate?
methyl 3,5-dipyridin-2-ylbenzoate has a molecular weight of 290.32 g/mol, XLogP of 3.60, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3,5-dipyridin-2-ylbenzoate is sourced from PubChem (CID 50905009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).