About 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine
6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine (PubChem CID 50905048) has the molecular formula C30H30ClFN4O2
and a molecular weight of 533.05 g/mol. Its IUPAC name is 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine |
| PubChem CID | 50905048 |
| Molecular Formula | C30H30ClFN4O2 |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine |
| SMILES | Cc1c(-c2ccccc2F)nc2ccc(Cl)cc2c1Nc1cc(N2CCOCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C30H30ClFN4O2/c1-20-29(23-4-2-3-5-25(23)32)33-26-8-6-21(31)18-24(26)30(20)34-27-19-22(35-10-14-37-15-11-35)7-9-28(27)36-12-16-38-17-13-36/h2-9,18-19H,10-17H2,1H3,(H,33,34) |
| InChIKey | WUWUBOGRHBRIGL-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine?
The IUPAC name of 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine (CID 50905048) is 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine.
What is the SMILES notation for 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine?
The canonical SMILES for 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine is Cc1c(-c2ccccc2F)nc2ccc(Cl)cc2c1Nc1cc(N2CCOCC2)ccc1N1CCOCC1.
What is the InChIKey of 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine?
The InChIKey is WUWUBOGRHBRIGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30ClFN4O2/c1-20-29(23-4-2-3-5-25(23)32)33-26-8-6-21(31)18-24(26)30(20)34-27-19-22(35-10-14-37-15-11-35)7-9-28(27)36-12-16-38-17-13-36/h2-9,18-19H,10-17H2,1H3,(H,33,34).
What are the key properties of 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine?
6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine has a molecular weight of 533.05 g/mol, XLogP of 6.42, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2,5-dimorpholin-4-ylphenyl)-2-(2-fluorophenyl)-3-methylquinolin-4-amine is sourced from PubChem (CID 50905048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).