C15H13N3O2S — CID 50905128
methyl 3-amino-6-(2-aminophenyl)thieno[3,2-b]pyridine-2-carboxylate (PubChem CID 50905128) has the molecular formula C15H13N3O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is methyl 3-amino-6-(2-aminophenyl)thieno[3,2-b]pyridine-2-carboxylate.
| Compound Name | methyl 3-amino-6-(2-aminophenyl)thieno[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 50905128 |
| Molecular Formula | C15H13N3O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | methyl 3-amino-6-(2-aminophenyl)thieno[3,2-b]pyridine-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(-c3ccccc3N)cnc2c1N |
| InChI | InChI=1S/C15H13N3O2S/c1-20-15(19)14-12(17)13-11(21-14)6-8(7-18-13)9-4-2-3-5-10(9)16/h2-7H,16-17H2,1H3 |
| InChIKey | RURIHABBHCMYSX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|