About ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate
ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate (PubChem CID 50905150) has the molecular formula C29H21N5O3
and a molecular weight of 487.52 g/mol. Its IUPAC name is ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate |
| PubChem CID | 50905150 |
| Molecular Formula | C29H21N5O3 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccc2)cc1C(=O)c1nn(-c2ccccc2)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C29H21N5O3/c1-2-37-29(36)26-24(19-33(31-26)21-14-8-4-9-15-21)28(35)25-23(18-30)27(20-12-6-3-7-13-20)34(32-25)22-16-10-5-11-17-22/h3-17,19H,2H2,1H3 |
| InChIKey | VZVNJWJTRGYEKS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 102.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate?
The IUPAC name of ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate (CID 50905150) is ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate.
What is the SMILES notation for ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate?
The canonical SMILES for ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate is CCOC(=O)c1nn(-c2ccccc2)cc1C(=O)c1nn(-c2ccccc2)c(-c2ccccc2)c1C#N.
What is the InChIKey of ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate?
The InChIKey is VZVNJWJTRGYEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H21N5O3/c1-2-37-29(36)26-24(19-33(31-26)21-14-8-4-9-15-21)28(35)25-23(18-30)27(20-12-6-3-7-13-20)34(32-25)22-16-10-5-11-17-22/h3-17,19H,2H2,1H3.
What are the key properties of ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate?
ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate has a molecular weight of 487.52 g/mol, XLogP of 5.00, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-phenylpyrazole-3-carboxylate is sourced from PubChem (CID 50905150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).