About ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate
ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate (PubChem CID 50905152) has the molecular formula C30H23N5O3
and a molecular weight of 501.55 g/mol. Its IUPAC name is ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate |
| PubChem CID | 50905152 |
| Molecular Formula | C30H23N5O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(C)cc2)cc1C(=O)c1nn(-c2ccccc2)c(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C30H23N5O3/c1-3-38-30(37)27-25(19-34(32-27)22-16-14-20(2)15-17-22)29(36)26-24(18-31)28(21-10-6-4-7-11-21)35(33-26)23-12-8-5-9-13-23/h4-17,19H,3H2,1-2H3 |
| InChIKey | FAZYUGQIKLHBTH-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 102.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate?
The IUPAC name of ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate (CID 50905152) is ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate.
What is the SMILES notation for ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate?
The canonical SMILES for ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate is CCOC(=O)c1nn(-c2ccc(C)cc2)cc1C(=O)c1nn(-c2ccccc2)c(-c2ccccc2)c1C#N.
What is the InChIKey of ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate?
The InChIKey is FAZYUGQIKLHBTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H23N5O3/c1-3-38-30(37)27-25(19-34(32-27)22-16-14-20(2)15-17-22)29(36)26-24(18-31)28(21-10-6-4-7-11-21)35(33-26)23-12-8-5-9-13-23/h4-17,19H,3H2,1-2H3.
What are the key properties of ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate?
ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate has a molecular weight of 501.55 g/mol, XLogP of 5.31, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-cyano-1,5-diphenylpyrazole-3-carbonyl)-1-(4-methylphenyl)pyrazole-3-carboxylate is sourced from PubChem (CID 50905152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).