C28H31F2N2O2+ — CID 50905308
2-[1-[3-(3,4-difluorophenoxy)propyl]-1-methylpyrrolidin-1-ium-3-yl]-2,2-diphenylacetamide (PubChem CID 50905308) has the molecular formula C28H31F2N2O2+ and a molecular weight of 465.56 g/mol. Its IUPAC name is 2-[1-[3-(3,4-difluorophenoxy)propyl]-1-methylpyrrolidin-1-ium-3-yl]-2,2-diphenylacetamide.
| Compound Name | 2-[1-[3-(3,4-difluorophenoxy)propyl]-1-methylpyrrolidin-1-ium-3-yl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 50905308 |
| Molecular Formula | C28H31F2N2O2+ |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 2-[1-[3-(3,4-difluorophenoxy)propyl]-1-methylpyrrolidin-1-ium-3-yl]-2,2-diphenylacetamide |
| SMILES | C[N+]1(CCCOc2ccc(F)c(F)c2)CCC(C(C(N)=O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C28H30F2N2O2/c1-32(16-8-18-34-24-13-14-25(29)26(30)19-24)17-15-23(20-32)28(27(31)33,21-9-4-2-5-10-21)22-11-6-3-7-12-22/h2-7,9-14,19,23H,8,15-18,20H2,1H3,(H-,31,33)/p+1 |
| InChIKey | NXGWPFXEDAGSMD-UHFFFAOYSA-O |
| XLogP | 4.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|