C7H8N2O2 — CID 50905339
(1R,4S,5S,6R)-5,6-dinitrosobicyclo[2.2.1]hept-2-ene (PubChem CID 50905339) has the molecular formula C7H8N2O2 and a molecular weight of 152.15 g/mol. Its IUPAC name is (1R,4S,5S,6R)-5,6-dinitrosobicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5S,6R)-5,6-dinitrosobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 50905339 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (1R,4S,5S,6R)-5,6-dinitrosobicyclo[2.2.1]hept-2-ene |
| SMILES | O=N[C@@H]1[C@H](N=O)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C7H8N2O2/c10-8-6-4-1-2-5(3-4)7(6)9-11/h1-2,4-7H,3H2/t4-,5+,6+,7- |
| InChIKey | KZEASGDRIBMWNT-RNGGSSJXSA-N |
| XLogP | 1.46 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|