About N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine
N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine (PubChem CID 50905359) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine.
Molecular Properties
| Compound Name | N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine |
| PubChem CID | 50905359 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine |
| SMILES | CCCc1noc(NC(C)C)n1 |
| InChI | InChI=1S/C8H15N3O/c1-4-5-7-10-8(12-11-7)9-6(2)3/h6H,4-5H2,1-3H3,(H,9,10,11) |
| InChIKey | FWPGUWVKGYZNFN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine?
The IUPAC name of N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine (CID 50905359) is N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine.
What is the SMILES notation for N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine?
The canonical SMILES for N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine is CCCc1noc(NC(C)C)n1.
What is the InChIKey of N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine?
The InChIKey is FWPGUWVKGYZNFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-4-5-7-10-8(12-11-7)9-6(2)3/h6H,4-5H2,1-3H3,(H,9,10,11).
What are the key properties of N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine?
N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine has a molecular weight of 169.23 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-3-propyl-1,2,4-oxadiazol-5-amine is sourced from PubChem (CID 50905359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).