About ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate
ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate (PubChem CID 50905474) has the molecular formula C17H13F2NO4
and a molecular weight of 333.29 g/mol. Its IUPAC name is ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate.
Molecular Properties
| Compound Name | ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate |
| PubChem CID | 50905474 |
| Molecular Formula | C17H13F2NO4 |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate |
| SMILES | CCOC(=O)C(F)c1nc2oc3ccc(F)cc3c(=O)c2cc1C |
| InChI | InChI=1S/C17H13F2NO4/c1-3-23-17(22)13(19)14-8(2)6-11-15(21)10-7-9(18)4-5-12(10)24-16(11)20-14/h4-7,13H,3H2,1-2H3 |
| InChIKey | FICBEDPZFKEFEF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate?
The IUPAC name of ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate (CID 50905474) is ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate.
What is the SMILES notation for ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate?
The canonical SMILES for ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate is CCOC(=O)C(F)c1nc2oc3ccc(F)cc3c(=O)c2cc1C.
What is the InChIKey of ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate?
The InChIKey is FICBEDPZFKEFEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F2NO4/c1-3-23-17(22)13(19)14-8(2)6-11-15(21)10-7-9(18)4-5-12(10)24-16(11)20-14/h4-7,13H,3H2,1-2H3.
What are the key properties of ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate?
ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate has a molecular weight of 333.29 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-2-(7-fluoro-3-methyl-5-oxochromeno[2,3-b]pyridin-2-yl)acetate is sourced from PubChem (CID 50905474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).