C25H28FNO3 — CID 50905520
3-[4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl]-6-(2-hydroxy-2-methylpropyl)-6-phenyl-1,3-oxazinan-2-one (PubChem CID 50905520) has the molecular formula C25H28FNO3 and a molecular weight of 409.50 g/mol. Its IUPAC name is 3-[4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl]-6-(2-hydroxy-2-methylpropyl)-6-phenyl-1,3-oxazinan-2-one.
| Compound Name | 3-[4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl]-6-(2-hydroxy-2-methylpropyl)-6-phenyl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 50905520 |
| Molecular Formula | C25H28FNO3 |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 3-[4-(4-fluorophenyl)-2-methylbut-3-yn-2-yl]-6-(2-hydroxy-2-methylpropyl)-6-phenyl-1,3-oxazinan-2-one |
| SMILES | CC(C)(O)CC1(c2ccccc2)CCN(C(C)(C)C#Cc2ccc(F)cc2)C(=O)O1 |
| InChI | InChI=1S/C25H28FNO3/c1-23(2,15-14-19-10-12-21(26)13-11-19)27-17-16-25(30-22(27)28,18-24(3,4)29)20-8-6-5-7-9-20/h5-13,29H,16-18H2,1-4H3 |
| InChIKey | ARKIMVVPWZUORY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|