C23H26O7 — CID 50905603
[(1R)-1-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] oxolane-2-carboxylate (PubChem CID 50905603) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is [(1R)-1-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] oxolane-2-carboxylate.
| Compound Name | [(1R)-1-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] oxolane-2-carboxylate |
|---|---|
| PubChem CID | 50905603 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(1R)-1-(5,8-dimethoxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] oxolane-2-carboxylate |
| SMILES | COc1ccc(OC)c2c1C(=O)C=C([C@@H](CC=C(C)C)OC(=O)C1CCCO1)C2=O |
| InChI | InChI=1S/C23H26O7/c1-13(2)7-8-16(30-23(26)19-6-5-11-29-19)14-12-15(24)20-17(27-3)9-10-18(28-4)21(20)22(14)25/h7,9-10,12,16,19H,5-6,8,11H2,1-4H3/t16-,19?/m1/s1 |
| InChIKey | ZHZIDBMZJNYKKL-VTBWFHPJSA-N |
| XLogP | 3.46 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|