About CID 50905672
CID 50905672 (PubChem CID 50905672) has the molecular formula C11H21BO2P
and a molecular weight of 227.07 g/mol.
Molecular Properties
| Compound Name | CID 50905672 |
| PubChem CID | 50905672 |
| Molecular Formula | C11H21BO2P |
| Molecular Weight | 227.07 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | — |
| SMILES | CCOP(C=C1CCCCC1)OCC.[B] |
| InChI | InChI=1S/C11H21O2P.B/c1-3-12-14(13-4-2)10-11-8-6-5-7-9-11;/h10H,3-9H2,1-2H3; |
| InChIKey | CJPFLZKZGXUBOF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.07 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 50905672 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 50905672?
The IUPAC name of CID 50905672 (CID 50905672) is not available.
What is the SMILES notation for CID 50905672?
The canonical SMILES for CID 50905672 is CCOP(C=C1CCCCC1)OCC.[B].
What is the InChIKey of CID 50905672?
The InChIKey is CJPFLZKZGXUBOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21O2P.B/c1-3-12-14(13-4-2)10-11-8-6-5-7-9-11;/h10H,3-9H2,1-2H3;.
What are the key properties of CID 50905672?
CID 50905672 has a molecular weight of 227.07 g/mol, XLogP of 3.84, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 50905672 is sourced from PubChem (CID 50905672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).