C19H16N4O — CID 50905756
3-ethyl-6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 50905756) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-ethyl-6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-ethyl-6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 50905756 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-ethyl-6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CCc1nnc2ccc(-c3ccc(Oc4ccccc4)cc3)nn12 |
| InChI | InChI=1S/C19H16N4O/c1-2-18-20-21-19-13-12-17(22-23(18)19)14-8-10-16(11-9-14)24-15-6-4-3-5-7-15/h3-13H,2H2,1H3 |
| InChIKey | WMSHCZHRRXPYJV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |