About 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile
4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile (PubChem CID 50905758) has the molecular formula C24H15N5O
and a molecular weight of 389.42 g/mol. Its IUPAC name is 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile |
| PubChem CID | 50905758 |
| Molecular Formula | C24H15N5O |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2nnc3ccc(-c4ccc(Oc5ccccc5)cc4)nn23)cc1 |
| InChI | InChI=1S/C24H15N5O/c25-16-17-6-8-19(9-7-17)24-27-26-23-15-14-22(28-29(23)24)18-10-12-21(13-11-18)30-20-4-2-1-3-5-20/h1-15H |
| InChIKey | MVRYOFUDXCXCDI-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 76.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile?
The IUPAC name of 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile (CID 50905758) is 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile.
What is the SMILES notation for 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile?
The canonical SMILES for 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile is N#Cc1ccc(-c2nnc3ccc(-c4ccc(Oc5ccccc5)cc4)nn23)cc1.
What is the InChIKey of 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile?
The InChIKey is MVRYOFUDXCXCDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15N5O/c25-16-17-6-8-19(9-7-17)24-27-26-23-15-14-22(28-29(23)24)18-10-12-21(13-11-18)30-20-4-2-1-3-5-20/h1-15H.
What are the key properties of 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile?
4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile has a molecular weight of 389.42 g/mol, XLogP of 5.12, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[6-(4-phenoxyphenyl)-[1,2,4]triazolo[4,3-b]pyridazin-3-yl]benzonitrile is sourced from PubChem (CID 50905758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).