C23H24N2O4 — CID 50905902
(2E,4E,6E)-4-(furan-2-carbonyl)-N,N,N',N'-tetramethyl-5-phenylocta-2,4,6-trienediamide (PubChem CID 50905902) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is (2E,4E,6E)-4-(furan-2-carbonyl)-N,N,N',N'-tetramethyl-5-phenylocta-2,4,6-trienediamide.
| Compound Name | (2E,4E,6E)-4-(furan-2-carbonyl)-N,N,N',N'-tetramethyl-5-phenylocta-2,4,6-trienediamide |
|---|---|
| PubChem CID | 50905902 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (2E,4E,6E)-4-(furan-2-carbonyl)-N,N,N',N'-tetramethyl-5-phenylocta-2,4,6-trienediamide |
| SMILES | CN(C)C(=O)/C=C/C(C(=O)c1ccco1)=C(/C=C/C(=O)N(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O4/c1-24(2)21(26)14-12-18(17-9-6-5-7-10-17)19(13-15-22(27)25(3)4)23(28)20-11-8-16-29-20/h5-16H,1-4H3/b14-12+,15-13+,19-18+ |
| InChIKey | SOASAPPFLKHGJQ-DMFABSADSA-N |
| XLogP | 3.20 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|