C24H16F5N5O3 — CID 50905972
3-[[difluoro-[6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methoxy]methyl]-5-phenyl-1,2-oxazole (PubChem CID 50905972) has the molecular formula C24H16F5N5O3 and a molecular weight of 517.41 g/mol. Its IUPAC name is 3-[[difluoro-[6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methoxy]methyl]-5-phenyl-1,2-oxazole.
| Compound Name | 3-[[difluoro-[6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methoxy]methyl]-5-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 50905972 |
| Molecular Formula | C24H16F5N5O3 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 517.12 |
| IUPAC Name | 3-[[difluoro-[6-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methoxy]methyl]-5-phenyl-1,2-oxazole |
| SMILES | FC(F)(F)COc1ccc(-c2ccc3nnc(C(F)(F)OCc4cc(-c5ccccc5)on4)n3c2)cn1 |
| InChI | InChI=1S/C24H16F5N5O3/c25-23(26,27)14-35-21-9-7-16(11-30-21)17-6-8-20-31-32-22(34(20)12-17)24(28,29)36-13-18-10-19(37-33-18)15-4-2-1-3-5-15/h1-12H,13-14H2 |
| InChIKey | LXQQBOQMXIDUDS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 87.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |