C31H32F2N4O2S — CID 50906139
N-(2,5-dimorpholin-4-ylphenyl)-5,7-difluoro-3-methyl-2-(2-methylsulfanylphenyl)quinolin-4-amine (PubChem CID 50906139) has the molecular formula C31H32F2N4O2S and a molecular weight of 562.69 g/mol. Its IUPAC name is N-(2,5-dimorpholin-4-ylphenyl)-5,7-difluoro-3-methyl-2-(2-methylsulfanylphenyl)quinolin-4-amine.
| Compound Name | N-(2,5-dimorpholin-4-ylphenyl)-5,7-difluoro-3-methyl-2-(2-methylsulfanylphenyl)quinolin-4-amine |
|---|---|
| PubChem CID | 50906139 |
| Molecular Formula | C31H32F2N4O2S |
| Molecular Weight | 562.69 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | N-(2,5-dimorpholin-4-ylphenyl)-5,7-difluoro-3-methyl-2-(2-methylsulfanylphenyl)quinolin-4-amine |
| SMILES | CSc1ccccc1-c1nc2cc(F)cc(F)c2c(Nc2cc(N3CCOCC3)ccc2N2CCOCC2)c1C |
| InChI | InChI=1S/C31H32F2N4O2S/c1-20-30(23-5-3-4-6-28(23)40-2)35-26-18-21(32)17-24(33)29(26)31(20)34-25-19-22(36-9-13-38-14-10-36)7-8-27(25)37-11-15-39-16-12-37/h3-8,17-19H,9-16H2,1-2H3,(H,34,35) |
| InChIKey | HGGUAQGFVGSBLC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.69 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|