C26H31N5O2 — CID 50906386
10-[2-[1-(4-tert-butylphenyl)ethylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 50906386) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is 10-[2-[1-(4-tert-butylphenyl)ethylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[2-[1-(4-tert-butylphenyl)ethylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 50906386 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | 10-[2-[1-(4-tert-butylphenyl)ethylamino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCNC(C)c3ccc(C(C)(C)C)cc3)c2cc1C |
| InChI | InChI=1S/C26H31N5O2/c1-15-13-20-21(14-16(15)2)31(23-22(28-20)24(32)30-25(33)29-23)12-11-27-17(3)18-7-9-19(10-8-18)26(4,5)6/h7-10,13-14,17,27H,11-12H2,1-6H3,(H,30,32,33) |
| InChIKey | VKGHMHHVTQSLBN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|