About tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate
tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate (PubChem CID 50906570) has the molecular formula C16H19FO3
and a molecular weight of 278.32 g/mol. Its IUPAC name is tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate |
| PubChem CID | 50906570 |
| Molecular Formula | C16H19FO3 |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate |
| SMILES | CC(=O)C1(C(=O)OC(C)(C)C)Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C16H19FO3/c1-10(18)16(14(19)20-15(2,3)4)8-11-5-6-13(17)7-12(11)9-16/h5-7H,8-9H2,1-4H3 |
| InChIKey | DLFMINLBXBYVER-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate?
The IUPAC name of tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate (CID 50906570) is tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate.
What is the SMILES notation for tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate?
The canonical SMILES for tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate is CC(=O)C1(C(=O)OC(C)(C)C)Cc2ccc(F)cc2C1.
What is the InChIKey of tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate?
The InChIKey is DLFMINLBXBYVER-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19FO3/c1-10(18)16(14(19)20-15(2,3)4)8-11-5-6-13(17)7-12(11)9-16/h5-7H,8-9H2,1-4H3.
What are the key properties of tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate?
tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate has a molecular weight of 278.32 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-acetyl-5-fluoro-1,3-dihydroindene-2-carboxylate is sourced from PubChem (CID 50906570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).