C25H26ClNO2 — CID 50906618
(1S,4S,5R,6S)-4-(chloromethyl)-3-[(1R)-1-naphthalen-1-ylethyl]-5-phenylmethoxy-7-oxa-3-azabicyclo[4.1.0]heptane (PubChem CID 50906618) has the molecular formula C25H26ClNO2 and a molecular weight of 407.94 g/mol. Its IUPAC name is (1S,4S,5R,6S)-4-(chloromethyl)-3-[(1R)-1-naphthalen-1-ylethyl]-5-phenylmethoxy-7-oxa-3-azabicyclo[4.1.0]heptane.
| Compound Name | (1S,4S,5R,6S)-4-(chloromethyl)-3-[(1R)-1-naphthalen-1-ylethyl]-5-phenylmethoxy-7-oxa-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 50906618 |
| Molecular Formula | C25H26ClNO2 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (1S,4S,5R,6S)-4-(chloromethyl)-3-[(1R)-1-naphthalen-1-ylethyl]-5-phenylmethoxy-7-oxa-3-azabicyclo[4.1.0]heptane |
| SMILES | C[C@H](c1cccc2ccccc12)N1C[C@@H]2O[C@@H]2[C@H](OCc2ccccc2)[C@H]1CCl |
| InChI | InChI=1S/C25H26ClNO2/c1-17(20-13-7-11-19-10-5-6-12-21(19)20)27-15-23-25(29-23)24(22(27)14-26)28-16-18-8-3-2-4-9-18/h2-13,17,22-25H,14-16H2,1H3/t17-,22-,23+,24-,25+/m1/s1 |
| InChIKey | GYGWGICKXXTAML-GBLYOKOSSA-N |
| XLogP | 5.18 |
| TPSA | 25.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|