C14H15N3O3 — CID 50906875
N-(2,2-dimethyl-5,7-dioxo-4,6-diazaspiro[2.4]heptan-6-yl)benzamide (PubChem CID 50906875) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-(2,2-dimethyl-5,7-dioxo-4,6-diazaspiro[2.4]heptan-6-yl)benzamide.
| Compound Name | N-(2,2-dimethyl-5,7-dioxo-4,6-diazaspiro[2.4]heptan-6-yl)benzamide |
|---|---|
| PubChem CID | 50906875 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-(2,2-dimethyl-5,7-dioxo-4,6-diazaspiro[2.4]heptan-6-yl)benzamide |
| SMILES | CC1(C)CC12NC(=O)N(NC(=O)c1ccccc1)C2=O |
| InChI | InChI=1S/C14H15N3O3/c1-13(2)8-14(13)11(19)17(12(20)15-14)16-10(18)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3,(H,15,20)(H,16,18) |
| InChIKey | MANUTYSYOFPZKE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|