About 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea
1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea (PubChem CID 50906925) has the molecular formula C22H25N3O
and a molecular weight of 347.46 g/mol. Its IUPAC name is 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea.
Molecular Properties
| Compound Name | 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea |
| PubChem CID | 50906925 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea |
| SMILES | CC(C)NC(=O)N(c1nc(-c2ccccc2)cc2ccccc12)C(C)C |
| InChI | InChI=1S/C22H25N3O/c1-15(2)23-22(26)25(16(3)4)21-19-13-9-8-12-18(19)14-20(24-21)17-10-6-5-7-11-17/h5-16H,1-4H3,(H,23,26) |
| InChIKey | FYFMAOCIISNLGF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea?
The IUPAC name of 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea (CID 50906925) is 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea.
What is the SMILES notation for 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea?
The canonical SMILES for 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea is CC(C)NC(=O)N(c1nc(-c2ccccc2)cc2ccccc12)C(C)C.
What is the InChIKey of 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea?
The InChIKey is FYFMAOCIISNLGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25N3O/c1-15(2)23-22(26)25(16(3)4)21-19-13-9-8-12-18(19)14-20(24-21)17-10-6-5-7-11-17/h5-16H,1-4H3,(H,23,26).
What are the key properties of 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea?
1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea has a molecular weight of 347.46 g/mol, XLogP of 5.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-phenylisoquinolin-1-yl)-1,3-di(propan-2-yl)urea is sourced from PubChem (CID 50906925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).