C14H26O12S — CID 50907097
(2R,3R,4R,5S,6S)-2-methoxy-6-[[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfonylmethyl]oxane-3,4,5-triol (PubChem CID 50907097) has the molecular formula C14H26O12S and a molecular weight of 418.42 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-2-methoxy-6-[[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfonylmethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S,6S)-2-methoxy-6-[[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfonylmethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 50907097 |
| Molecular Formula | C14H26O12S |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (2R,3R,4R,5S,6S)-2-methoxy-6-[[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methylsulfonylmethyl]oxane-3,4,5-triol |
| SMILES | CO[C@@H]1O[C@H](CS(=O)(=O)C[C@H]2O[C@@H](OC)[C@H](O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H26O12S/c1-23-13-11(19)9(17)7(15)5(25-13)3-27(21,22)4-6-8(16)10(18)12(20)14(24-2)26-6/h5-20H,3-4H2,1-2H3/t5-,6-,7-,8-,9-,10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | XPAUCTZKSHWPRS-BHPPVPTJSA-N |
| XLogP | -4.69 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |