C14H10Cl2N2O4S — CID 50907168
2,3-dichloro-6,8-dimethyl-1-nitro-10H-phenothiazine 5,5-dioxide (PubChem CID 50907168) has the molecular formula C14H10Cl2N2O4S and a molecular weight of 373.22 g/mol. Its IUPAC name is 2,3-dichloro-6,8-dimethyl-1-nitro-10H-phenothiazine 5,5-dioxide.
| Compound Name | 2,3-dichloro-6,8-dimethyl-1-nitro-10H-phenothiazine 5,5-dioxide |
|---|---|
| PubChem CID | 50907168 |
| Molecular Formula | C14H10Cl2N2O4S |
| Molecular Weight | 373.22 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 2,3-dichloro-6,8-dimethyl-1-nitro-10H-phenothiazine 5,5-dioxide |
| SMILES | Cc1cc(C)c2c(c1)Nc1c(cc(Cl)c(Cl)c1[N+](=O)[O-])S2(=O)=O |
| InChI | InChI=1S/C14H10Cl2N2O4S/c1-6-3-7(2)14-9(4-6)17-12-10(23(14,21)22)5-8(15)11(16)13(12)18(19)20/h3-5,17H,1-2H3 |
| InChIKey | JDSUAXYZEGYQSP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|