C20H24N6O5S — CID 50907211
(2R)-1-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl]-N-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 50907211) has the molecular formula C20H24N6O5S and a molecular weight of 460.52 g/mol. Its IUPAC name is (2R)-1-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl]-N-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-1-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl]-N-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 50907211 |
| Molecular Formula | C20H24N6O5S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (2R)-1-[2-(7,8-dimethyl-2,4-dioxobenzo[g]pteridin-10-yl)ethyl]-N-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCN3CCC[C@@H]3C(=O)NS(C)(=O)=O)c2cc1C |
| InChI | InChI=1S/C20H24N6O5S/c1-11-9-13-15(10-12(11)2)26(17-16(21-13)19(28)23-20(29)22-17)8-7-25-6-4-5-14(25)18(27)24-32(3,30)31/h9-10,14H,4-8H2,1-3H3,(H,24,27)(H,23,28,29)/t14-/m1/s1 |
| InChIKey | VYDCQEUODANHLY-CQSZACIVSA-N |
| XLogP | -0.26 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|