About 1-amino-2,4,4-trimethylpentane-2-sulfonic acid
1-amino-2,4,4-trimethylpentane-2-sulfonic acid (PubChem CID 50907415) has the molecular formula C8H19NO3S
and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-amino-2,4,4-trimethylpentane-2-sulfonic acid.
Molecular Properties
| Compound Name | 1-amino-2,4,4-trimethylpentane-2-sulfonic acid |
| PubChem CID | 50907415 |
| Molecular Formula | C8H19NO3S |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-amino-2,4,4-trimethylpentane-2-sulfonic acid |
| SMILES | CC(C)(C)CC(C)(CN)S(=O)(=O)O |
| InChI | InChI=1S/C8H19NO3S/c1-7(2,3)5-8(4,6-9)13(10,11)12/h5-6,9H2,1-4H3,(H,10,11,12) |
| InChIKey | OETVOBQZNKXBTI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-2,4,4-trimethylpentane-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2,4,4-trimethylpentane-2-sulfonic acid?
The IUPAC name of 1-amino-2,4,4-trimethylpentane-2-sulfonic acid (CID 50907415) is 1-amino-2,4,4-trimethylpentane-2-sulfonic acid.
What is the SMILES notation for 1-amino-2,4,4-trimethylpentane-2-sulfonic acid?
The canonical SMILES for 1-amino-2,4,4-trimethylpentane-2-sulfonic acid is CC(C)(C)CC(C)(CN)S(=O)(=O)O.
What is the InChIKey of 1-amino-2,4,4-trimethylpentane-2-sulfonic acid?
The InChIKey is OETVOBQZNKXBTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19NO3S/c1-7(2,3)5-8(4,6-9)13(10,11)12/h5-6,9H2,1-4H3,(H,10,11,12).
What are the key properties of 1-amino-2,4,4-trimethylpentane-2-sulfonic acid?
1-amino-2,4,4-trimethylpentane-2-sulfonic acid has a molecular weight of 209.31 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2,4,4-trimethylpentane-2-sulfonic acid is sourced from PubChem (CID 50907415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).