About 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide
1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide (PubChem CID 50907490) has the molecular formula C20H22Cl2N4O2
and a molecular weight of 421.33 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide |
| PubChem CID | 50907490 |
| Molecular Formula | C20H22Cl2N4O2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCCCO)nn(-c2ccc(Cl)cc2Cl)c1-n1cccc1 |
| InChI | InChI=1S/C20H22Cl2N4O2/c1-14-18(19(28)23-9-3-2-6-12-27)24-26(20(14)25-10-4-5-11-25)17-8-7-15(21)13-16(17)22/h4-5,7-8,10-11,13,27H,2-3,6,9,12H2,1H3,(H,23,28) |
| InChIKey | FXIMAZQXUVYWEV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide?
The IUPAC name of 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide (CID 50907490) is 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide.
What is the SMILES notation for 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide?
The canonical SMILES for 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide is Cc1c(C(=O)NCCCCCO)nn(-c2ccc(Cl)cc2Cl)c1-n1cccc1.
What is the InChIKey of 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide?
The InChIKey is FXIMAZQXUVYWEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22Cl2N4O2/c1-14-18(19(28)23-9-3-2-6-12-27)24-26(20(14)25-10-4-5-11-25)17-8-7-15(21)13-16(17)22/h4-5,7-8,10-11,13,27H,2-3,6,9,12H2,1H3,(H,23,28).
What are the key properties of 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide?
1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide has a molecular weight of 421.33 g/mol, XLogP of 4.17, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dichlorophenyl)-N-(5-hydroxypentyl)-4-methyl-5-pyrrol-1-ylpyrazole-3-carboxamide is sourced from PubChem (CID 50907490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).