C22H26Cl2N4O — CID 50907495
1-(2,4-dichlorophenyl)-5-(2,5-dimethylpyrrol-1-yl)-4-methyl-N-pentylpyrazole-3-carboxamide (PubChem CID 50907495) has the molecular formula C22H26Cl2N4O and a molecular weight of 433.38 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-(2,5-dimethylpyrrol-1-yl)-4-methyl-N-pentylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-5-(2,5-dimethylpyrrol-1-yl)-4-methyl-N-pentylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 50907495 |
| Molecular Formula | C22H26Cl2N4O |
| Molecular Weight | 433.38 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-(2,5-dimethylpyrrol-1-yl)-4-methyl-N-pentylpyrazole-3-carboxamide |
| SMILES | CCCCCNC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(-n2c(C)ccc2C)c1C |
| InChI | InChI=1S/C22H26Cl2N4O/c1-5-6-7-12-25-21(29)20-16(4)22(27-14(2)8-9-15(27)3)28(26-20)19-11-10-17(23)13-18(19)24/h8-11,13H,5-7,12H2,1-4H3,(H,25,29) |
| InChIKey | CMHCZVLVBJHYLV-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.38 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|