C19H17NO7 — CID 50907508
(3S,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(S)-hydroxy-(4-nitrophenyl)methyl]oxolan-2-one (PubChem CID 50907508) has the molecular formula C19H17NO7 and a molecular weight of 371.35 g/mol. Its IUPAC name is (3S,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(S)-hydroxy-(4-nitrophenyl)methyl]oxolan-2-one.
| Compound Name | (3S,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(S)-hydroxy-(4-nitrophenyl)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 50907508 |
| Molecular Formula | C19H17NO7 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (3S,4R)-4-(1,3-benzodioxol-5-ylmethyl)-3-[(S)-hydroxy-(4-nitrophenyl)methyl]oxolan-2-one |
| SMILES | O=C1OC[C@H](Cc2ccc3c(c2)OCO3)[C@H]1[C@H](O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17NO7/c21-18(12-2-4-14(5-3-12)20(23)24)17-13(9-25-19(17)22)7-11-1-6-15-16(8-11)27-10-26-15/h1-6,8,13,17-18,21H,7,9-10H2/t13-,17-,18+/m0/s1 |
| InChIKey | SOALSOCFLGLPKW-DOPJRALCSA-N |
| XLogP | 2.39 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|