About 1,4-bis(1-adamantyl)butane-1,4-diol
1,4-bis(1-adamantyl)butane-1,4-diol (PubChem CID 50907552) has the molecular formula C24H38O2
and a molecular weight of 358.57 g/mol. Its IUPAC name is 1,4-bis(1-adamantyl)butane-1,4-diol.
Molecular Properties
| Compound Name | 1,4-bis(1-adamantyl)butane-1,4-diol |
| PubChem CID | 50907552 |
| Molecular Formula | C24H38O2 |
| Molecular Weight | 358.57 g/mol |
| Exact Mass | 358.29 |
| IUPAC Name | 1,4-bis(1-adamantyl)butane-1,4-diol |
| SMILES | OC(CCC(O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H38O2/c25-21(23-9-15-3-16(10-23)5-17(4-15)11-23)1-2-22(26)24-12-18-6-19(13-24)8-20(7-18)14-24/h15-22,25-26H,1-14H2 |
| InChIKey | LNINDBUCTFERQR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-bis(1-adamantyl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(1-adamantyl)butane-1,4-diol?
The IUPAC name of 1,4-bis(1-adamantyl)butane-1,4-diol (CID 50907552) is 1,4-bis(1-adamantyl)butane-1,4-diol.
What is the SMILES notation for 1,4-bis(1-adamantyl)butane-1,4-diol?
The canonical SMILES for 1,4-bis(1-adamantyl)butane-1,4-diol is OC(CCC(O)C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of 1,4-bis(1-adamantyl)butane-1,4-diol?
The InChIKey is LNINDBUCTFERQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H38O2/c25-21(23-9-15-3-16(10-23)5-17(4-15)11-23)1-2-22(26)24-12-18-6-19(13-24)8-20(7-18)14-24/h15-22,25-26H,1-14H2.
What are the key properties of 1,4-bis(1-adamantyl)butane-1,4-diol?
1,4-bis(1-adamantyl)butane-1,4-diol has a molecular weight of 358.57 g/mol, XLogP of 4.92, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(1-adamantyl)butane-1,4-diol is sourced from PubChem (CID 50907552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).