C28H31F5O2S — CID 50907631
(11R,13S,17S)-11-(4-ethylsulfanylphenyl)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 50907631) has the molecular formula C28H31F5O2S and a molecular weight of 526.61 g/mol. Its IUPAC name is (11R,13S,17S)-11-(4-ethylsulfanylphenyl)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11R,13S,17S)-11-(4-ethylsulfanylphenyl)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 50907631 |
| Molecular Formula | C28H31F5O2S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | (11R,13S,17S)-11-(4-ethylsulfanylphenyl)-17-hydroxy-13-methyl-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CCSc1ccc([C@H]2C[C@@]3(C)C(CC[C@@]3(O)C(F)(F)C(F)(F)F)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C28H31F5O2S/c1-3-36-19-8-4-16(5-9-19)22-15-25(2)23(12-13-26(25,35)27(29,30)28(31,32)33)21-10-6-17-14-18(34)7-11-20(17)24(21)22/h4-5,8-9,14,21-23,35H,3,6-7,10-13,15H2,1-2H3/t21?,22-,23?,25+,26+/m1/s1 |
| InChIKey | VENHNEYODXAEBY-GAMJZTEASA-N |
| XLogP | 7.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|