C22H26Cl2N4O2 — CID 50907705
1-(2,4-dichlorophenyl)-5-(2,5-dimethylpyrrol-1-yl)-N-(5-hydroxypentyl)-4-methylpyrazole-3-carboxamide (PubChem CID 50907705) has the molecular formula C22H26Cl2N4O2 and a molecular weight of 449.38 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-(2,5-dimethylpyrrol-1-yl)-N-(5-hydroxypentyl)-4-methylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-5-(2,5-dimethylpyrrol-1-yl)-N-(5-hydroxypentyl)-4-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 50907705 |
| Molecular Formula | C22H26Cl2N4O2 |
| Molecular Weight | 449.38 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-(2,5-dimethylpyrrol-1-yl)-N-(5-hydroxypentyl)-4-methylpyrazole-3-carboxamide |
| SMILES | Cc1c(C(=O)NCCCCCO)nn(-c2ccc(Cl)cc2Cl)c1-n1c(C)ccc1C |
| InChI | InChI=1S/C22H26Cl2N4O2/c1-14-7-8-15(2)27(14)22-16(3)20(21(30)25-11-5-4-6-12-29)26-28(22)19-10-9-17(23)13-18(19)24/h7-10,13,29H,4-6,11-12H2,1-3H3,(H,25,30) |
| InChIKey | RRKHFMZRDDPEFW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 72.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|