C18H19ClN2O2 — CID 5090775
[1-[3-(4-chloro-3-methylphenoxy)propyl]benzimidazol-2-yl]methanol (PubChem CID 5090775) has the molecular formula C18H19ClN2O2 and a molecular weight of 330.82 g/mol. Its IUPAC name is [1-[3-(4-chloro-3-methylphenoxy)propyl]benzimidazol-2-yl]methanol.
| Compound Name | [1-[3-(4-chloro-3-methylphenoxy)propyl]benzimidazol-2-yl]methanol |
|---|---|
| PubChem CID | 5090775 |
| Molecular Formula | C18H19ClN2O2 |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | [1-[3-(4-chloro-3-methylphenoxy)propyl]benzimidazol-2-yl]methanol |
| SMILES | Cc1cc(OCCCn2c(CO)nc3ccccc32)ccc1Cl |
| InChI | InChI=1S/C18H19ClN2O2/c1-13-11-14(7-8-15(13)19)23-10-4-9-21-17-6-3-2-5-16(17)20-18(21)12-22/h2-3,5-8,11,22H,4,9-10,12H2,1H3 |
| InChIKey | GJNWZLLGDFNTRY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|