C15H9N5Se — CID 50907804
20-methyl-11-selena-3,5,6,8,13-pentazapentacyclo[10.8.0.02,10.05,9.014,19]icosa-1(20),2(10),3,6,8,12,14,16,18-nonaene (PubChem CID 50907804) has the molecular formula C15H9N5Se and a molecular weight of 338.23 g/mol. Its IUPAC name is 20-methyl-11-selena-3,5,6,8,13-pentazapentacyclo[10.8.0.02,10.05,9.014,19]icosa-1(20),2(10),3,6,8,12,14,16,18-nonaene.
| Compound Name | 20-methyl-11-selena-3,5,6,8,13-pentazapentacyclo[10.8.0.02,10.05,9.014,19]icosa-1(20),2(10),3,6,8,12,14,16,18-nonaene |
|---|---|
| PubChem CID | 50907804 |
| Molecular Formula | C15H9N5Se |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 20-methyl-11-selena-3,5,6,8,13-pentazapentacyclo[10.8.0.02,10.05,9.014,19]icosa-1(20),2(10),3,6,8,12,14,16,18-nonaene |
| SMILES | Cc1c2ccccc2nc2[se]c3c(ncn4ncnc34)c12 |
| InChI | InChI=1S/C15H9N5Se/c1-8-9-4-2-3-5-10(9)19-15-11(8)12-13(21-15)14-16-6-18-20(14)7-17-12/h2-7H,1H3 |
| InChIKey | CUJPNCYPRLHERK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|