C21H14BrNO4S2 — CID 50907910
2-[(5E)-5-[[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 50907910) has the molecular formula C21H14BrNO4S2 and a molecular weight of 488.38 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 50907910 |
| Molecular Formula | C21H14BrNO4S2 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 486.95 |
| IUPAC Name | 2-[(5E)-5-[[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)/C(=C\c2ccc(/C=C/C(=O)c3ccc(Br)cc3)cc2)SC1=S |
| InChI | InChI=1S/C21H14BrNO4S2/c22-16-8-6-15(7-9-16)17(24)10-5-13-1-3-14(4-2-13)11-18-20(27)23(12-19(25)26)21(28)29-18/h1-11H,12H2,(H,25,26)/b10-5+,18-11+ |
| InChIKey | HCTLQAWAUXHOMZ-KKJJYVQDSA-N |
| XLogP | 4.63 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|