C18H15N3S — CID 50907938
2-(1,3-diphenylpyrazol-4-yl)-4,5-dihydro-1,3-thiazole (PubChem CID 50907938) has the molecular formula C18H15N3S and a molecular weight of 305.41 g/mol. Its IUPAC name is 2-(1,3-diphenylpyrazol-4-yl)-4,5-dihydro-1,3-thiazole.
| Compound Name | 2-(1,3-diphenylpyrazol-4-yl)-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 50907938 |
| Molecular Formula | C18H15N3S |
| Molecular Weight | 305.41 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-(1,3-diphenylpyrazol-4-yl)-4,5-dihydro-1,3-thiazole |
| SMILES | c1ccc(-c2nn(-c3ccccc3)cc2C2=NCCS2)cc1 |
| InChI | InChI=1S/C18H15N3S/c1-3-7-14(8-4-1)17-16(18-19-11-12-22-18)13-21(20-17)15-9-5-2-6-10-15/h1-10,13H,11-12H2 |
| InChIKey | AFXXCPQTMPJAJW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |