About [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate
[5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate (PubChem CID 50907950) has the molecular formula C24H19Cl3N2O4
and a molecular weight of 505.79 g/mol. Its IUPAC name is [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate.
Molecular Properties
| Compound Name | [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate |
| PubChem CID | 50907950 |
| Molecular Formula | C24H19Cl3N2O4 |
| Molecular Weight | 505.79 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate |
| SMILES | CC(=O)N[C@@H](Cc1ccccc1)C(=O)Oc1cc(Cl)ccc1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H19Cl3N2O4/c1-14(30)28-21(11-15-5-3-2-4-6-15)24(32)33-22-12-16(25)7-9-18(22)23(31)29-17-8-10-19(26)20(27)13-17/h2-10,12-13,21H,11H2,1H3,(H,28,30)(H,29,31)/t21-/m0/s1 |
| InChIKey | PMXMTOYIBZTDIA-NRFANRHFSA-N |
| XLogP | 5.55 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.79 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate?
The IUPAC name of [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate (CID 50907950) is [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate.
What is the SMILES notation for [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate?
The canonical SMILES for [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate is CC(=O)N[C@@H](Cc1ccccc1)C(=O)Oc1cc(Cl)ccc1C(=O)Nc1ccc(Cl)c(Cl)c1.
What is the InChIKey of [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate?
The InChIKey is PMXMTOYIBZTDIA-NRFANRHFSA-N. The full InChI is InChI=1S/C24H19Cl3N2O4/c1-14(30)28-21(11-15-5-3-2-4-6-15)24(32)33-22-12-16(25)7-9-18(22)23(31)29-17-8-10-19(26)20(27)13-17/h2-10,12-13,21H,11H2,1H3,(H,28,30)(H,29,31)/t21-/m0/s1.
What are the key properties of [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate?
[5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate has a molecular weight of 505.79 g/mol, XLogP of 5.55, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-chloro-2-[(3,4-dichlorophenyl)carbamoyl]phenyl] (2S)-2-acetamido-3-phenylpropanoate is sourced from PubChem (CID 50907950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).